CAS 3026696-97-6 is the registry number for 2,6-dichloro-8-methoxyquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
2,6-dichloro-8-methoxyquinoline (CAS 3026696-97-6) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 2,6-dichloro-8-methoxyquinoline. InChIKey: ZBXJLABRPUVOIG-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2,6-dichloro-8-methoxyquinoline |
| InChIKey | ZBXJLABRPUVOIG-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)Cl)C=CC(=N2)Cl |
Computed by PubChem (NCBI)