Products 3029269-79-9
CAS 3029269-79-9 appears in our catalog under these names: 2-(AMINOMETHYL)-4H-PYRIDO[1,2-A]PYRIMIDIN-4-ONE HYDROCHLORIDE, 95%, 95%, 2-(Aminomethyl)-4H-pyrido[1,2-a]pyrimidin-4-one hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(aminomethyl)pyrido[1,2-a]pyrimidin-4-one;hydrochloride (CAS 3029269-79-9) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 2-(aminomethyl)pyrido[1,2-a]pyrimidin-4-one;hydrochloride. InChIKey: UOXHRQUOYQCEOT-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 2-(aminomethyl)pyrido[1,2-a]pyrimidin-4-one;hydrochloride |
| InChIKey | UOXHRQUOYQCEOT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1)CN.Cl |
Computed by PubChem (NCBI)