CAS 3077-85-8 appears in our catalog under these names: 3-Nitro-9H-carbazole, 97%, 3-Nitrocarbazole 97%, 3-Nitro-9H-carbazole, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 50g, 100g.
3-nitro-9H-carbazole (CAS 3077-85-8) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 3-nitro-9H-carbazole. InChIKey: ZYNHZTIMNJKVLK-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 3-nitro-9H-carbazole |
| InChIKey | ZYNHZTIMNJKVLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)