CAS 3129-16-6 is the registry number for Methyl 4-(2,2-dicyanovinyl)benzoate. Offered by: Biosynth. Available pack sizes: 5g, 10g.
Methyl 4-(2,2-dicyanoethenyl)benzoate (CAS 3129-16-6) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: methyl 4-(2,2-dicyanoethenyl)benzoate. InChIKey: FBOCHORMPUIPSN-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | methyl 4-(2,2-dicyanoethenyl)benzoate |
| InChIKey | FBOCHORMPUIPSN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C=C(C#N)C#N |
Computed by PubChem (NCBI)