CAS 332065-12-0 is the registry number for N-(4-Cyanophenyl)furan-2-carboxamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
N-(4-cyanophenyl)furan-2-carboxamide (CAS 332065-12-0) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: N-(4-cyanophenyl)furan-2-carboxamide. InChIKey: MXCQGSKHIBMFMM-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | N-(4-cyanophenyl)furan-2-carboxamide |
| InChIKey | MXCQGSKHIBMFMM-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)