Products 33254-87-4
CAS 33254-87-4 appears in our catalog under these names: Indobufen Impurity 33, Indobufen Impurity 29. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 5-(2-chloroacetyl)-2-hydroxybenzoate (CAS 33254-87-4) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: methyl 5-(2-chloroacetyl)-2-hydroxybenzoate. InChIKey: HZDXLMKEOXIOPH-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | methyl 5-(2-chloroacetyl)-2-hydroxybenzoate |
| InChIKey | HZDXLMKEOXIOPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C(=O)CCl)O |
Computed by PubChem (NCBI)