Products 33282-22-3
CAS 33282-22-3 appears in our catalog under these names: 5-(4-Chlorophenyl)isoxazole-3-carboxylic acid, 97%, 97%, 5-(4-Chloro-phenyl)-isoxazole-3-carboxylic acid, 97%, 5-(4-Chlorophenyl)isoxazole-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g.
5-(4-chlorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-22-3) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: CRTZVRLESCICCT-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | CRTZVRLESCICCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)Cl |
Computed by PubChem (NCBI)