CAS 337958-60-8 appears in our catalog under these names: 5,7–Dichloro–1,6–naphthyridine, 5,7-Dichloro-1,6-naphthyridine, 97%, 5,7-Dichloro-1,6-naphthyridine 97%, 5,7-Dichloro-1,6-naphthyridine, 97%, 97%, 5,7-Dichloro-1,6-naphthyridine, 98%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 500mg.
5,7-dichloro-1,6-naphthyridine (CAS 337958-60-8) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 5,7-dichloro-1,6-naphthyridine. InChIKey: HNRPBMNTCYRAJD-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 5,7-dichloro-1,6-naphthyridine |
| InChIKey | HNRPBMNTCYRAJD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2N=C1)Cl)Cl |
Computed by PubChem (NCBI)