CAS 341556-86-3 appears in our catalog under these names: (2E,2'E)–3,3'–(Anthracene–9,10–diyl)diacrylic acid, (2E,2'E)-3,3'-(Anthracene-9,10-diyl)diacrylic acid, 97%, 97%, (2E,2'E)-3,3'-(Anthracene-9,10-diyl)diacrylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
(E)-3-[10-[(E)-2-carboxyethenyl]anthracen-9-yl]prop-2-enoic acid (CAS 341556-86-3) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: (E)-3-[10-[(E)-2-carboxyethenyl]anthracen-9-yl]prop-2-enoic acid. InChIKey: QGJNKGPCTYCXLD-WGDLNXRISA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | (E)-3-[10-[(E)-2-carboxyethenyl]anthracen-9-yl]prop-2-enoic acid |
| InChIKey | QGJNKGPCTYCXLD-WGDLNXRISA-N |
| SMILES | C1=CC=C2C(=C3C(=C(C2=C1)/C=C/C(=O)O)C=CC=C3)/C=C/C(=O)O |
Computed by PubChem (NCBI)