Products 342899-07-4
CAS 342899-07-4 appears in our catalog under these names: 2-Ethyl-4-methoxyphenylboronic acid, 98%, 2-Ethyl-4-methoxyphenylboronic acid, 95-<97%, 2-Ethyl-4-methoxyphenylboronic acid, ≥97-<99%, (2-Ethyl-4-methoxyphenyl)boronic acid, 97%, (2-Ethyl-4-methoxyphenyl)boronic acid, 98%. Offered by: Chemat, Hoffman Fine Chemicals, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 2,5g, 10g, 25g.
(2-ethyl-4-methoxyphenyl)boronic acid (CAS 342899-07-4) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (2-ethyl-4-methoxyphenyl)boronic acid. InChIKey: JHTURCRYQLGBFW-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (2-ethyl-4-methoxyphenyl)boronic acid |
| InChIKey | JHTURCRYQLGBFW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)CC)(O)O |
Computed by PubChem (NCBI)