CAS 34352-92-6 is the registry number for Naproxen Impurity 16. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-methoxy-6-prop-1-en-2-ylnaphthalene (CAS 34352-92-6) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 2-methoxy-6-prop-1-en-2-ylnaphthalene. InChIKey: RQCAOSNEXWLSCC-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2-methoxy-6-prop-1-en-2-ylnaphthalene |
| InChIKey | RQCAOSNEXWLSCC-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)