Products 34352-92-6

CAS 34352-92-6 is the registry number for Naproxen Impurity 16. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-methoxy-6-prop-1-en-2-ylnaphthalene (CAS 34352-92-6) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 2-methoxy-6-prop-1-en-2-ylnaphthalene. InChIKey: RQCAOSNEXWLSCC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O
Molecular weight198.26 g/mol
IUPAC name2-methoxy-6-prop-1-en-2-ylnaphthalene
InChIKeyRQCAOSNEXWLSCC-UHFFFAOYSA-N
SMILESCC(=C)C1=CC2=C(C=C1)C=C(C=C2)OC

Computed by PubChem (NCBI)