CAS 35008-62-9 is the registry number for N-(4-Isothiocyanatophenyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(4-isothiocyanatophenyl)acetamide (CAS 35008-62-9) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: N-(4-isothiocyanatophenyl)acetamide. InChIKey: OSGLRYINFGRXPC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | N-(4-isothiocyanatophenyl)acetamide |
| InChIKey | OSGLRYINFGRXPC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)N=C=S |
Computed by PubChem (NCBI)