CAS 35714-20-6 appears in our catalog under these names: (4-Benzylphenyl)methanol, 97%, (4-Benzylphenyl)methanol, (4-Benzylphenyl)methanol, 98%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 25mg, 2,5g, 250mg.
(4-benzylphenyl)methanol (CAS 35714-20-6) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: (4-benzylphenyl)methanol. InChIKey: MHZOFWFRCQRXIH-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | (4-benzylphenyl)methanol |
| InChIKey | MHZOFWFRCQRXIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)