CAS 35989-28-7 appears in our catalog under these names: 2,5-Dichloro-4-fluorobenzoic acid, 2,5-Dichloro-4-fluorobenzoic acid 97%, 2,5-Dichloro-4-fluorobenzoic acid, 97%, 97%, 2,5-Dichloro-4-fluorobenzoic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 500mg.
2,5-dichloro-4-fluorobenzoic acid (CAS 35989-28-7) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,5-dichloro-4-fluorobenzoic acid. InChIKey: DJSYJVXNIQXPCN-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO2 |
|---|---|
| Molecular weight | 209.00 g/mol |
| IUPAC name | 2,5-dichloro-4-fluorobenzoic acid |
| InChIKey | DJSYJVXNIQXPCN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)Cl)C(=O)O |
Computed by PubChem (NCBI)