Products 35989-28-7

CAS 35989-28-7 appears in our catalog under these names: 2,5-Dichloro-4-fluorobenzoic acid, 2,5-Dichloro-4-fluorobenzoic acid 97%, 2,5-Dichloro-4-fluorobenzoic acid, 97%, 97%, 2,5-Dichloro-4-fluorobenzoic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 500mg.

Structural formula: {0} (CAS {1})

2,5-dichloro-4-fluorobenzoic acid (CAS 35989-28-7) is a chemical compound with the molecular formula C7H3Cl2FO2 and a molecular weight of 209.00 g/mol. IUPAC name: 2,5-dichloro-4-fluorobenzoic acid. InChIKey: DJSYJVXNIQXPCN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2FO2
Molecular weight209.00 g/mol
IUPAC name2,5-dichloro-4-fluorobenzoic acid
InChIKeyDJSYJVXNIQXPCN-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Cl)F)Cl)C(=O)O

Computed by PubChem (NCBI)