Products 36404-33-8
CAS 36404-33-8 appears in our catalog under these names: 4-(4-Chlorophenyl)-2,3-dihydro-1,3-oxazol-2-one, 95%, 4-(4-Chlorophenyl)-2,3-dihydro-1,3-oxazol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(4-chlorophenyl)-3H-1,3-oxazol-2-one (CAS 36404-33-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 4-(4-chlorophenyl)-3H-1,3-oxazol-2-one. InChIKey: CKBZKDNZRNRXGW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3H-1,3-oxazol-2-one |
| InChIKey | CKBZKDNZRNRXGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=COC(=O)N2)Cl |
Computed by PubChem (NCBI)