Products 36556-55-5
CAS 36556-55-5 is the registry number for 1-CHLORO-3,5-DIFLUORO-2-NITROBENZENE, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
1-chloro-3,5-difluoro-2-nitrobenzene (CAS 36556-55-5) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 1-chloro-3,5-difluoro-2-nitrobenzene. InChIKey: MWYQVPGRHISKQU-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 1-chloro-3,5-difluoro-2-nitrobenzene |
| InChIKey | MWYQVPGRHISKQU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)