Products 368-72-9
CAS 368-72-9 appears in our catalog under these names: 3-AMINO-4-CHLOROBENZENESULFONYL FLUORIDE, 98%, 3-Amino-4-chlorobenzene-1-sulfonyl fluoride, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-amino-4-chlorobenzenesulfonyl fluoride (CAS 368-72-9) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 3-amino-4-chlorobenzenesulfonyl fluoride. InChIKey: HNZYBSQZUOJCDN-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 3-amino-4-chlorobenzenesulfonyl fluoride |
| InChIKey | HNZYBSQZUOJCDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)F)N)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Amino-4-chlorobenzenesulphonyl fluoride, 3-Amino-4-chlorobenzenesulfonyl fluoride, 3-amino-4-chlorobenzene-1-sulfonyl fluoride, Benzenesulfonylfluoride, 3-amino-4-chloro-, Benzenesulfonyl fluoride, 3-amino-4-chloro-, starbld0017926, (3-amino-4-chlorophenyl)fluorosulfone, 3-Amino-4-chloro benzene sulphonyl fluoride, 3-azanyl-4-chloranyl-benzenesulfonyl fluoride, 3-Amino-4-chlorobenzenesulfonyl fluoride, 99+%