Products 372078-45-0
CAS 372078-45-0 is the registry number for 5-Hydrazino-2(1H)-quinolinone Hydrochloride. Offered by: TRC. Available pack sizes: 250mg, 25mg.
5-hydrazinyl-1H-quinolin-2-one;hydrochloride (CAS 372078-45-0) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 5-hydrazinyl-1H-quinolin-2-one;hydrochloride. InChIKey: HDODLESYIRAYEI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 5-hydrazinyl-1H-quinolin-2-one;hydrochloride |
| InChIKey | HDODLESYIRAYEI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)N2)C(=C1)NN.Cl |
Computed by PubChem (NCBI)