CAS 3722-52-9 appears in our catalog under these names: 3–Methoxy–9H–xanthen–9–one, 3-Methoxy-9H-xanthen-9-one, 97%. Offered by: GLPBio, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-methoxyxanthen-9-one (CAS 3722-52-9) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-methoxyxanthen-9-one. InChIKey: HGWDKWJYTURSFE-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-methoxyxanthen-9-one |
| InChIKey | HGWDKWJYTURSFE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3O2 |
Computed by PubChem (NCBI)