Products 375368-88-0
CAS 375368-88-0 appears in our catalog under these names: 3-(2,5-Difluorophenyl)acrylic acid, 95% +(E), 95% +(E), 3-(2,5-Difluorophenyl)acrylic acid, 95% +(E). Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
(E)-3-(2,5-difluorophenyl)prop-2-enoic acid (CAS 375368-88-0) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: (E)-3-(2,5-difluorophenyl)prop-2-enoic acid. InChIKey: XAWHCSKPALFWBI-DAFODLJHSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | (E)-3-(2,5-difluorophenyl)prop-2-enoic acid |
| InChIKey | XAWHCSKPALFWBI-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1F)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(2,5-difluorophenyl)prop-2-enoic acid, trans-2,5-Difluorocinnamic acid, 2,5-Difluorocinnamic acid, (E)-3-(2,5-Difluorophenyl)acrylic acid, 3-(2,5-Difluorophenyl)acrylic acid, (E)-3-(2,5-difluorophenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(2,5-difluorophenyl)-, (2E)-, 2,5-difluorocinnamicacid, (2E)-3-(2,5-Difluorophenyl)-2-propenoic acid #, (2E)-3-(2,5-Difluorophenyl)acrylic acid