CAS 39588-73-3 is the registry number for 3,5-dichloro-1,6-naphthyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dichloro-1,6-naphthyridine (CAS 39588-73-3) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 3,5-dichloro-1,6-naphthyridine. InChIKey: LLKSAEZFPYIDMW-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 3,5-dichloro-1,6-naphthyridine |
| InChIKey | LLKSAEZFPYIDMW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1N=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)