CAS 39959-87-0 appears in our catalog under these names: 2-(2,3-Dichlorophenoxy)ethan-1-amine hydrochloride, 98%, 1-(2-Aminoethoxy)-2,3-dichlorobenzene hydrochloride, 2-(2,3-Dichlorophenoxy)ethan-1-amine hydrochloride, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 25g, 10g, 2,5g, 250mg, 100mg, 1g, 5g.
2-(2,3-dichlorophenoxy)ethanamine;hydrochloride (CAS 39959-87-0) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-(2,3-dichlorophenoxy)ethanamine;hydrochloride. InChIKey: WXJRJTRCMNYTHI-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-(2,3-dichlorophenoxy)ethanamine;hydrochloride |
| InChIKey | WXJRJTRCMNYTHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OCCN.Cl |
Computed by PubChem (NCBI)