CAS 39959-91-6 appears in our catalog under these names: [2-(3,4-DICHLOROPHENOXY)ETHYL]AMINE HYDROCHLORIDE, 97%, 97%, 2-(3,4-Dichlorophenoxy)ethanamine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
2-(3,4-dichlorophenoxy)ethanamine;hydrochloride (CAS 39959-91-6) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-(3,4-dichlorophenoxy)ethanamine;hydrochloride. InChIKey: XAGBIKYSBMHDBA-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-(3,4-dichlorophenoxy)ethanamine;hydrochloride |
| InChIKey | XAGBIKYSBMHDBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCCN)Cl)Cl.Cl |
Computed by PubChem (NCBI)