Products 403860-10-6
CAS 403860-10-6 is the registry number for Methyl 2-chloro-6H-thieno(2,3-b)pyrrole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate (CAS 403860-10-6) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: methyl 2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate. InChIKey: PUVPNBQYYYYQCY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | methyl 2-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate |
| InChIKey | PUVPNBQYYYYQCY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)SC(=C2)Cl |
Computed by PubChem (NCBI)