Products 406676-21-9
CAS 406676-21-9 appears in our catalog under these names: 5-Chloro-2,3-difluoropyridine-4-carboxylic acid, 5-chloro-2,3-difluoropyridine-4-carboxylic acid, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 10g.
5-chloro-2,3-difluoropyridine-4-carboxylic acid (CAS 406676-21-9) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 5-chloro-2,3-difluoropyridine-4-carboxylic acid. InChIKey: VGJLRTQANXKSET-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 5-chloro-2,3-difluoropyridine-4-carboxylic acid |
| InChIKey | VGJLRTQANXKSET-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)