CAS 41125-77-3 appears in our catalog under these names: 5-(4-Nitrophenyl)-3H-1,3,4-oxadiazol-2-one, 95%, 5-(4-Nitrophenyl)-1,3,4-oxadiazol-2-ol, 95%, 5-(4-Nitrophenyl)-1,3,4-oxadiazol-2-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g.
5-(4-nitrophenyl)-3H-1,3,4-oxadiazol-2-one (CAS 41125-77-3) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-(4-nitrophenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: ADUFTMJBLYUADS-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | ADUFTMJBLYUADS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)