CAS 885519-61-9 appears in our catalog under these names: 6-Nitro-1h-indazole-4-carboxylic acid, 95%, 6–Nitro–1H–indazol–4–carboxylic acid, 6-Nitro-1H-indazole-4-carboxylic acid 95+%, 6-Nitro-1H-indazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 50mg.
6-nitro-1H-indazole-4-carboxylic acid (CAS 885519-61-9) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 6-nitro-1H-indazole-4-carboxylic acid. InChIKey: YAHBWBBCYGPFHL-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 6-nitro-1H-indazole-4-carboxylic acid |
| InChIKey | YAHBWBBCYGPFHL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(=O)O)C=NN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)