CAS 883290-89-9 appears in our catalog under these names: 5-Nitro-1h-indazole-7-carboxylic acid, 95%, 5-Nitro-1H-indazole-7-carboxylic Acid, 5-Nitro-1H-indazole-7-carboxylic acid, 98%, 98%, 5-Nitro-1H-indazole-7-carboxylic acid, 98%. Offered by: Combi-blocks, TRC, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 100mg, 5g.
5-nitro-1H-indazole-7-carboxylic acid (CAS 883290-89-9) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-nitro-1H-indazole-7-carboxylic acid. InChIKey: NQJHZWSGEIJEDP-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-nitro-1H-indazole-7-carboxylic acid |
| InChIKey | NQJHZWSGEIJEDP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)