CAS 83725-79-5 appears in our catalog under these names: 5-(2-Nitrophenyl)-3H-1,3,4-oxadiazol-2-one, 97%, 5-(2-Nitrophenyl)-3H-1,3,4-oxadiazol-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
5-(2-nitrophenyl)-3H-1,3,4-oxadiazol-2-one (CAS 83725-79-5) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-(2-nitrophenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: ZJSUVFMYVANOMJ-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-(2-nitrophenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | ZJSUVFMYVANOMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=O)O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)