CAS 574738-64-0 appears in our catalog under these names: 7-Hydroxy-6-nitro-3H-quinazolin-4-one, 97%, 6-Nitroquinazoline-4,7-diol, 95%, Maihuatini Impurity 1. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, on request.
7-hydroxy-6-nitro-3H-quinazolin-4-one (CAS 574738-64-0) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 7-hydroxy-6-nitro-3H-quinazolin-4-one. InChIKey: DGAQZMKEHDOLCK-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 7-hydroxy-6-nitro-3H-quinazolin-4-one |
| InChIKey | DGAQZMKEHDOLCK-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1[N+](=O)[O-])O)N=CNC2=O |
Computed by PubChem (NCBI)