Products 3682-15-3
CAS 3682-15-3 appears in our catalog under these names: 3-NITROPHTHALHYDRAZIDE, 3-Nitrophthalhydrazide, 95%, 3–Nitrophthalic Hydrazide, 3-Nitrophthalic Hydrazide, >97.0%(T), 5-Nitro-2,3-dihydrophthalazine-1,4-dione. Offered by: Sigma-Aldrich, Combi-blocks, GLPBio, TCI, Biosynth. Available pack sizes: 25G, 5g, 1g, 0,005kg, 0,01kg, 0,025kg, 25kg, 10g.
5-nitro-2,3-dihydrophthalazine-1,4-dione (CAS 3682-15-3) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-nitro-2,3-dihydrophthalazine-1,4-dione. InChIKey: YVOBBFQJMOGQOU-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-nitro-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | YVOBBFQJMOGQOU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NNC2=O |
Computed by PubChem (NCBI)
Synonyms:
5-nitro-2,3-dihydrophthalazine-1,4-dione, 1,4-Phthalazinedione, 2,3-dihydro-5-nitro-, 3-Nitro-phthalhydrazide, YVOBBFQJMOGQOU-UHFFFAOYSA-, 3-Nitrophthalhydrazide, 3-Nitrophthalic Hydrazide, 2,3-Dihydro-5-nitro-1,4-phthalazinedione, 5-nitrophthalhydrazide, 3-Nitrophthalic hydrazine, Oprea1_294149