CAS 83725-80-8 is the registry number for 5-(3-Nitrophenyl)-3H-1,3,4-oxadiazol-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
5-(3-nitrophenyl)-3H-1,3,4-oxadiazol-2-one (CAS 83725-80-8) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-(3-nitrophenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: MVNRZPOCXZUMNP-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | MVNRZPOCXZUMNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NNC(=O)O2 |
Computed by PubChem (NCBI)