Products 41473-09-0
CAS 41473-09-0 is the registry number for Fenmetozole. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(3,4-dichlorophenoxy)methyl]-4,5-dihydro-1H-imidazole (CAS 41473-09-0) is a chemical compound with the molecular formula C10H10Cl2N2O and a molecular weight of 245.10 g/mol. IUPAC name: 2-[(3,4-dichlorophenoxy)methyl]-4,5-dihydro-1H-imidazole. InChIKey: FVHAONUKSUFJKN-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenoxy)methyl]-4,5-dihydro-1H-imidazole |
| InChIKey | FVHAONUKSUFJKN-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)COC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)