Products 4802-88-4

CAS 4802-88-4 is the registry number for 2-(2,4-Dioxo-1,2,3,4-tetrahydroquinazolin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(2,4-dioxoquinazolin-1-yl)acetic acid (CAS 4802-88-4) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 2-(2,4-dioxoquinazolin-1-yl)acetic acid. InChIKey: MLQXNJCIGWKSPF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N2O4
Molecular weight220.18 g/mol
IUPAC name2-(2,4-dioxoquinazolin-1-yl)acetic acid
InChIKeyMLQXNJCIGWKSPF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)NC(=O)N2CC(=O)O

Computed by PubChem (NCBI)