Products 4889-98-9
CAS 4889-98-9 is the registry number for Anagyrine Related Compound 2. Offered by: Chemat Brand. Available pack sizes: on request.
3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone (CAS 4889-98-9) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone. InChIKey: GYVWSEJMJPHQKM-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone |
| InChIKey | GYVWSEJMJPHQKM-UHFFFAOYSA-N |
| SMILES | C1C2C(=O)NC(=O)C1C(=O)NC2=O |
Computed by PubChem (NCBI)