CAS 493036-46-7 is the registry number for 2-(3,5-Difluorophenyl)malondialdehyde, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-(3,5-difluorophenyl)propanedial (CAS 493036-46-7) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 2-(3,5-difluorophenyl)propanedial. InChIKey: CMXQLSBYVLYHDM-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)propanedial |
| InChIKey | CMXQLSBYVLYHDM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(C=O)C=O |
Computed by PubChem (NCBI)