CAS 494780-00-6 is the registry number for 3-Benzyl-1,2,4-oxadiazole-5-thiol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-benzyl-2H-1,2,4-oxadiazole-5-thione (CAS 494780-00-6) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 3-benzyl-2H-1,2,4-oxadiazole-5-thione. InChIKey: NIXGUOXKUZKPIQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 3-benzyl-2H-1,2,4-oxadiazole-5-thione |
| InChIKey | NIXGUOXKUZKPIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=S)ON2 |
Computed by PubChem (NCBI)