Products 497060-15-8
CAS 497060-15-8 is the registry number for 2,6-difluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
2,6-difluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide (CAS 497060-15-8) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 2,6-difluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide. InChIKey: ASUKHYBSPPHBKO-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 2,6-difluoro-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| InChIKey | ASUKHYBSPPHBKO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)