CAS 51497-55-3 is the registry number for 2-{8-Oxatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaen-4-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-dibenzofuran-2-ylacetic acid (CAS 51497-55-3) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-dibenzofuran-2-ylacetic acid. InChIKey: DOGYSAWVOSELAN-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-dibenzofuran-2-ylacetic acid |
| InChIKey | DOGYSAWVOSELAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)CC(=O)O |
Computed by PubChem (NCBI)