CAS 521059-43-8 appears in our catalog under these names: (2S,3R)-3-Phenyl Isoserine Hydrochloride, 95%, (alphaS,betaR)-beta-Phenyl Isoserine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(2S,3R)-3-amino-2-hydroxy-3-phenylpropanoic acid;hydrochloride (CAS 521059-43-8) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: (2S,3R)-3-amino-2-hydroxy-3-phenylpropanoic acid;hydrochloride. InChIKey: OTJZSGZNPDLQAJ-WLYNEOFISA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | (2S,3R)-3-amino-2-hydroxy-3-phenylpropanoic acid;hydrochloride |
| InChIKey | OTJZSGZNPDLQAJ-WLYNEOFISA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@@H](C(=O)O)O)N.Cl |
Computed by PubChem (NCBI)