Products 949459-75-0
CAS 949459-75-0 is the registry number for (alphaS,betaS)-beta-Phenyl Isoserine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(2S,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid;hydrochloride (CAS 949459-75-0) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: (2S,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid;hydrochloride. InChIKey: OTJZSGZNPDLQAJ-WSZWBAFRSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | (2S,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid;hydrochloride |
| InChIKey | OTJZSGZNPDLQAJ-WSZWBAFRSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@@H](C(=O)O)O)N.Cl |
Computed by PubChem (NCBI)