CAS 52220-74-3 is the registry number for 2-(2,5-Dimethylphenyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(2,5-dimethylphenyl)phenol (CAS 52220-74-3) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)phenol. InChIKey: JYTQBTDWTJXTSS-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)phenol |
| InChIKey | JYTQBTDWTJXTSS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=CC=CC=C2O |
Computed by PubChem (NCBI)