CAS 52814-86-5 is the registry number for 2-(4-Hydroxyphenyl)-5-benzofuranol. Offered by: TRC. Available pack sizes: 100mg.
2-(4-hydroxyphenyl)-1-benzofuran-5-ol (CAS 52814-86-5) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1-benzofuran-5-ol. InChIKey: SNNNDCMXZYWCCI-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-1-benzofuran-5-ol |
| InChIKey | SNNNDCMXZYWCCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(O2)C=CC(=C3)O)O |
Computed by PubChem (NCBI)