Products 53948-08-6
CAS 53948-08-6 appears in our catalog under these names: Aristolactam A III, Aristolactam A III. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1 mg, 5 mg.
14-hydroxy-4,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one (CAS 53948-08-6) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 14-hydroxy-4,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one. InChIKey: XQTQPBAROQYWHN-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 14-hydroxy-4,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one |
| InChIKey | XQTQPBAROQYWHN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C3C4=C(C=C2C=C1)NC(=O)C4=CC(=C3OC)O |
Computed by PubChem (NCBI)