CAS 54258-43-4 is the registry number for 1,10-phenanthroline-5,6-diol. Offered by: Chemat Brand. Available pack sizes: on request.
1,10-phenanthroline-5,6-diol (CAS 54258-43-4) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 1,10-phenanthroline-5,6-diol. InChIKey: JDVMJFIBTWIYJX-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 1,10-phenanthroline-5,6-diol |
| InChIKey | JDVMJFIBTWIYJX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C(=C2O)O)N=C1 |
Computed by PubChem (NCBI)