CAS 54857-54-4 is the registry number for 3-Methanesulfonylbenzoyl chloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-methylsulfonylbenzoyl chloride (CAS 54857-54-4) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 3-methylsulfonylbenzoyl chloride. InChIKey: BHKRMQZNFPIGNQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 3-methylsulfonylbenzoyl chloride |
| InChIKey | BHKRMQZNFPIGNQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C(=O)Cl |
Computed by PubChem (NCBI)