CAS 54973-78-3 appears in our catalog under these names: Methyl 6-nitronicotinate, 98%, Methyl 6-nitronicotinate, 96%, Methyl 6-nitronicotinate 96%, Methyl 6-nitronicotinate, 96%, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
Methyl 6-nitropyridine-3-carboxylate (CAS 54973-78-3) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: methyl 6-nitropyridine-3-carboxylate. InChIKey: PHIAHISRDZCZKN-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | methyl 6-nitropyridine-3-carboxylate |
| InChIKey | PHIAHISRDZCZKN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)