Products 5521-60-8
CAS 5521-60-8 appears in our catalog under these names: 5-Methylpyrazine-2,3-dicarboxylic acid, 95%, 5-Methylpyrazine-2,3-dicarboxylic acid, 98%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-methylpyrazine-2,3-dicarboxylic acid (CAS 5521-60-8) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 5-methylpyrazine-2,3-dicarboxylic acid. InChIKey: ZSVGGGCOTVOOSG-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 5-methylpyrazine-2,3-dicarboxylic acid |
| InChIKey | ZSVGGGCOTVOOSG-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Methylpyrazine-2,3-dicarboxylic acid, 5-Methyl-2,3-pyrazinedicarboxylic acid, 2,3-Pyrazinedicarboxylic acid, 5-methyl-, Glipizide Impurity 41, 5-Methylyrazine-2,3-dicarboxylicacid, 5-Methylpyrazine-2,3-dicarboxylicacid, NCIOpen2_001375, ZSVGGGCOTVOOSG-UHFFFAOYSA-N, sodium 5-methylpyrazine-2,3-dicarboxylate, 1-[4-(diethylamino)anilino]ethanesulfonic acid