Products 552297-00-4
CAS 552297-00-4 is the registry number for 5-Chloro-2-methyl-1H-indene-3-acetic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(6-chloro-2-methyl-3H-inden-1-yl)acetic acid (CAS 552297-00-4) is a chemical compound with the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. IUPAC name: 2-(6-chloro-2-methyl-3H-inden-1-yl)acetic acid. InChIKey: VYTBYYRVDGIZIS-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO2 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 2-(6-chloro-2-methyl-3H-inden-1-yl)acetic acid |
| InChIKey | VYTBYYRVDGIZIS-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C1)C=CC(=C2)Cl)CC(=O)O |
Computed by PubChem (NCBI)