CAS 55544-00-8 appears in our catalog under these names: Diflunisal Methyl Ester, Methyl 2',4'-difluoro-4-hydroxy-[1,1'-biphenyl]-3-carboxylate 97%, Methyl 2',4'-difluoro-4-hydroxy-[1,1'-biphenyl]-3-carboxylate, 97%, 97%. Offered by: Mikromol, Ambeed, Chemat. Available pack sizes: 4x25mg, 25mg, 100mg, 250mg, 1g, 5g.
Methyl 5-(2,4-difluorophenyl)-2-hydroxybenzoate (CAS 55544-00-8) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: methyl 5-(2,4-difluorophenyl)-2-hydroxybenzoate. InChIKey: QMPIMDAYFIIMIH-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | methyl 5-(2,4-difluorophenyl)-2-hydroxybenzoate |
| InChIKey | QMPIMDAYFIIMIH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C2=C(C=C(C=C2)F)F)O |
Computed by PubChem (NCBI)